Product Detail
Product Tags
| |
|
| Product name： |
Taraxerol |
| Synonym： |
Skimmiol; Alnulin |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
|
| Chemical Family： |
|
| Canonical SMILES： |
CC1(CCC2(CC=C3C4(CCC5C(C(CCC5(C4CCC3(C2C1)C)C)O)(C)C)C)C)C |
| Botanical Source： |
Taraxacum officinale (dandelion), Alnus spp., Skimmia japonica, Rhododendron spp., Euphorbia spp. and other plants. Rather widely distributed. Also the lichen Pertusaria ophthalmiza (poss. not a genuine lichen constit.) |
Previous: Rutaevin
Next: Isopteropodine
