Product Detail
Product Tags
| |
|
| Product name： |
Solasodine |
| Synonym： |
Solancarpidine; Purapuridine; Solanidine S; Solancarpine |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
C[C@@H]1CN[C@@]2(CC1)O[C@@H]1C[C@@H]3[C@H]4CC=C5C[C@H](O)CC[C@@]5(C)[C@@H]4CC[C@@]3(C)[C@@H]1[C@H]2C |
| Botanical Source： |
Solanum aculeatissimum, Solanum canense, Solanum cyananthum, Solanum fraxinifolium, Cestrum purpureum and other plants, v. widely distributed in the Solanaceae as the alkamine glycoside alkaloids |
Previous: glaucocalyxin A
Next: Corydaline
