Product Detail
Product Tags
| |
|
| Product name： |
Scutellarein |
| Synonym： |
6-Hydroxyapigenin |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
light brown |
| Chemical Family： |
Flavonoids |
| Canonical SMILES： |
OC1=C(O)C2C(=O)C=C(OC=2C=C1O)C1C=CC(O)=CC=1 |
| Botanical Source： |
roots, stems and flowers of Scutellaria spp. Billbergia vittata, Pinguicula vulgaris, leaves of Clerodendrum phlomides and Clerodendrum serratum, from the aerial parts of Stachys inflata, and from various other plants |
Previous: Syringic acid
Next: Norisoboldine
