Product Detail
Product Tags
| |
|
| Product name： |
Reserpine |
| Synonym： |
|
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
COC1C=C(C=C(OC)C=1OC)C(=O)O[C@@H]1C[C@@H]2CN3CCC4C5C=CC(=CC=5NC=4[C@H]3C[C@@H]2[C@@H]([C@H]1OC)C(=O)OC)OC |
| Botanical Source： |
Alkaloid from Rauwolfia serpentina, Rauwolfia vomitoria, Rauwolfia macrophylla, very many other Rauwolfia spp., Vinca minor, Alstonia constricta and many other spp. in the Apocynaceae, e.g. Vallesia dichotoma and Excavatia coccinea (preferred genus name |
Previous: Jujuboside A
Next: Eugenol
