Product Detail
Product Tags
| |
|
| Product name： |
Raubasine |
| Synonym： |
Ajmalicine; Raubasine; δ-Yohimbine; Vinceine; Vincaine; Py-tetrahydroserpentine; Lamuran |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
C[C@@H]1OC=C([C@H]2C[C@H]3C4NC5=CC=CC=C5C=4CCN3C[C@H]12)C(=O)OC |
| Botanical Source： |
Alkaloid from Rauwolfia serpentina, many other Rauwolfia spp., Vinca rosea and many other spp. in the Apocynaceae |
Previous: Cimigenol-3-O-alpha-L-arabinoside
Next: Ginkgolic Acid C15:1
