Product Detail
Product Tags
| |
|
| Product name： |
Quercetin |
| Synonym： |
Sophoretin; Meletin; Quercetol; Quertin; Ericin |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Yellow powder |
| Chemical Family： |
Flavonoids |
| Canonical SMILES： |
C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
| Botanical Source： |
many plants, esp. fruits, such as Helichrysum, Euphorbia and Karwinskia spp. Present in the Solanaceae, Rhamnaceae, Passifloraceae and many other families. For example detected in almost all studied Umbelliferae |
Previous: Emodin
Next: Paeonol
