Product Detail
Product Tags
|
|
Product name: |
Procyanidin B2 |
Synonym: |
Proanthocyanidin B2 |
Purity: |
98% + by HPLC |
Analysis Method: |
|
Identification Method: |
|
Appearance: |
Off-white powder |
Chemical Family: |
Polyphenols |
Canonical SMILES: |
O[C@H]1[C@H](OC2C=C(O)C=C(O)C=2[C@@H]1C1C2O[C@@H]([C@H](O)CC=2C(O)=CC=1O)C1=CC(O)=C(O)C=C1)C1=CC(O)=C(O)C=C1 |
Botanical Source: |
Occurs in Crataegus, Cotoneaster, Nelia meyeri, Malus and Aesculus spp. peanut skins and buckwheat grain |
Previous: Cyanidin-3-glucoside chloride
Next: Hecogenin