Product Detail
Product Tags
| |
|
| Product name： |
Norisoboldine |
| Synonym： |
Laurelliptine |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
COC1=CC2CCN[C@H]3CC4C=C(O)C(=CC=4C(C=23)=C1O)OC |
| Botanical Source： |
Beilschmiedia elliptica, Beilschmiedia podagrica, Cassytha pubescens, Monodora tenuifolia, Litsea xylanica and some other Litsea spp., Zizyphus jujuba, Nectandra rigida and (possibly) Monanthotaxis cauliflora (Lauraceae, Annonaceae, Rhamnac |
Previous: Dendrobine
Next: Cyanidin Chloride
