Product Detail
Product Tags
| |
|
| Product name： |
Narciclasine |
| Synonym： |
Lycoricidinol |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
C1OC2=C(O1)C(=C3C(=C2)C4=CC(C(C(C4NC3=O)O)O)O)O |
| Botanical Source： |
Alkaloid from Narcissus incomparabilis, all Narcissus spp. examined, and present in many other Amaryllidaceae spp. Also found in the Texas grasshopper Brachystola magna |
Previous: Quercetin 3-O-β-D-glucose-7-O-β-D-gentiobioside
Next: Macranthoidin A
