Product Detail
Product Tags
| |
|
| Product name： |
Monotropein |
| Synonym： |
|
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Off-white powder |
| Chemical Family： |
Iridoids |
| Canonical SMILES： |
OC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H]2[C@@H]1C=C[C@]2(O)CO |
| Botanical Source： |
Monotropa hypopithys, Monotropa uniflora, Liquidambar styraciflua (sweet gum), Liquidambar orientalis (oriental sweet gum) and Pyrola renifolia. Widespread in the Pyrolaceae. Present in fruits of cranberry and other Vaccinium spp. |
Previous: Cyanidin-3-glucoside chloride
Next: Hecogenin
