Product Detail
Product Tags
| |
|
| Product name： |
Medicagenic acid |
| Synonym： |
Catsanogenin; Medicogenic acid |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
off white powder |
| Chemical Family： |
Triterpenoids |
| Canonical SMILES： |
CC1(C)C[C@@H]2C3=CC[C@H]4[C@]5(C)C[C@@H](O)[C@@H](O)[C@@](C)([C@H]5CC[C@]4(C)[C@@]3(C)CC[C@@]2(CC1)C(O)=O)C(O)=O |
| Botanical Source： |
Aglycone from Root of Medicago sativa (alfalfa), other Medicago spp., Castanospermum australe and others |
Previous: Ligupurpuroside C
Next: Humulone
