Product Detail
Product Tags
| |
|
| Product name： |
Magnoflorine |
| Synonym： |
Escholine chloride |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Pale yellow powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
C[N+]1(CCC2=CC(=C(C3=C2C1CC4=C3C(=C(C=C4)OC)O)O)OC)C.[Cl-] |
| Botanical Source： |
Magnolia obovata (Magnoliaceae) and Aquilegia hybrida (Ranunculaceae), also from the Annonaceae, Berberidaceae, Euphorbiaceae, Menispermaceae, Papaveraceae, Rutaceae, Aristolochiaceae, Fumariaceae and Rhamnaceae |
Previous: Cimigenol-3-O-alpha-L-arabinoside
Next: Ginkgolic Acid C15:1
