Product Detail
Product Tags
| |
|
| Product name： |
Lutein |
| Synonym： |
Xanthophyll; β,ε-Carotene-3,3′-diol |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Red powder |
| Chemical Family： |
Carotenoids |
| Canonical SMILES： |
CC1C[C@@H](O)CC(C)(C)C=1/C=C/C(/C)=C/C=C/C(/C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/[C@@H]1C(C)=C[C@@H](O)CC1(C)C |
| Botanical Source： |
Pigment from egg yolk and leaves. Found in all higher plants, e.g. Mimosa invasiva, Cosmos caudatus, and also in microorganisms e.g. Staphylococcus aureus, green algae, Porphyra spp and in animals, e.g river crab Potamon dehaani and marine invertebrates |
Previous: Ganoderic acid E
Next: 5-O-Demethylnobiletin
