Product Detail
Product Tags
| |
|
| Product name： |
Lupeol |
| Synonym： |
Monogynol B; Fagarasterol; β-Viscol; Cautchicol; Xanthosterin; Clerodol |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Triterpenes |
| Canonical SMILES： |
CC1(C)[C@@H](O)CC[C@@]2(C)[C@H]1CC[C@]1(C)[C@@H]2CC[C@@H]2[C@H]3[C@@H](CC[C@]3(C)CC[C@@]12C)C(C)=C |
| Botanical Source： |
Occurs in many plants, e.g. Ficus, Manilkara spp. First isol. in 1889 from Lupinus luteus. One of the most widespread of the pentacyclic triterpenes |
Previous: Syringic acid
Next: Norisoboldine
