Product Detail
Product Tags
| |
|
| Product name： |
Limonin |
| Synonym： |
Limone; Citrolimonin; Evodine; Dictamnolactone; Obaculactone |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Light yellow powder |
| Chemical Family： |
Lactones |
| Canonical SMILES： |
CC1(C2CC(=O)C3(C(C24COC(=O)CC4O1)CCC5(C36C(O6)C(=O)OC5C7=COC=C7)C)C)C |
| Botanical Source： |
oranges and other citrus fruits (Citrus spp.). Also from other Rutaceae spp., e.g. Evodia, Phellodendron, Dictamnus and Luvunga spp. |
Previous: parthenolide
Next: 3-Isomangostin
