Product Detail
Product Tags
| |
|
| Product name： |
Juglone |
| Synonym： |
5-Hydroxy-1,4-naphthoquinone |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
|
| Chemical Family： |
|
| Canonical SMILES： |
OC1=CC=CC2=C1C(=O)C=CC2=O |
| Botanical Source： |
Occurs in Juglans spp.; leaves and nuts of pecan (Carya illinoensis), leaves of Pterocarya fraxinifolia, Lomatia spp. and Platycarya strobilacea. Also prod. by Penicillium diversum var. aureum and a mutant of Verticillium dahliae |
Previous: Lappaconitine hydrobromide
Next: Butyl 4-Hydroxybenzoate
