Product Detail
Product Tags
| |
|
| Product name： |
Jatrorrhizine |
| Synonym： |
Neprotine; Yatrorizine; Jateorhizine; Dehydrocorypalmine |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Yellow powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
[I-].COC1C2C=[N+]3CCC4C=C(O)C(=CC=4C3=CC=2C=CC=1OC)OC |
| Botanical Source： |
Quaternary alkaloid from the root of Jateorhiza palmata, many Berberis and Mahonia spp. Coptis sp., Thalictrum javanicum, Thalictrum cultratum, Tinospora cordifolia, Enantia chloranthra and many other spp. in several families |
Previous: Ciwujianoside B
Next: Neohesperidin
