Product Detail
Product Tags
| |
|
| Product name： |
Hyoscyamine |
| Synonym： |
Hyoscyamine; Daturine; Duboisine |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
|
| Chemical Family： |
Alkaloid |
| Canonical SMILES： |
CN1[C@@H]2C[C@H](C[C@H]1CC2)OC(=O)[C@@H](CO)C1C=CC=CC=1 |
| Botanical Source： |
Alkaloid from Atropa, Datura, Duboisia, Hyoscyamus, Anthocercis and Scopolia spp. , Mandragora officinarum and several other genera in the Solanaceae, esp. some strains of Duboisia myoporoides |
Previous: Desacetylcinobufagin
Next: Liquidambaric lactone
