Product Detail
Product Tags
| |
|
| Product name： |
Hyoscine |
| Synonym： |
Scopolamine; Transcop; Transderm-Scop; Tropic acid ester with scopine; l-Scopolamine |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Oil |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
CN1C2CC(CC1C1OC12)OC(=O)C(CO)C1C=CC=CC=1 |
| Botanical Source： |
Alkaloid from Atropa, Datura, Hyoscyamus and Scopolia spp. and several other genera in the Solanaceae. Coml. sources are Datura metel, Datura meteloides and Datura fastuosa var alba |
Previous: Quercetin 3-O-β-D-glucose-7-O-β-D-gentiobioside
Next: Macranthoidin A
