Product Detail
Product Tags
| |
|
| Product name： |
Glucoraphanin |
| Synonym： |
4-(Methylsulfinyl)butyl glucosinolate |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Pale yellow powder |
| Chemical Family： |
Miscellaneous |
| Canonical SMILES： |
CS(=O)CCCC/C(=NOS(O)(=O)=O)/S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| Botanical Source： |
radish (Raphanus sativus) and Brassica sp. seeds or tops. Also isol. as the L-proline salt from the flowering heads of Cardaria draba (preferred genus name Lepidium) |
Previous: Pseudolaric acid C
Next: Quercetin-3-O-[α-L-rhamnose-(1→2)-β-D-glucopyranosyl]-5-O-β-D-glucopyranoside
