Product Detail
Product Tags
| |
|
| Product name： |
Gardenin B |
| Synonym： |
5-Hydroxy-4′,6,7,8-tetramethoxyflavone; 5-O-Demethyltangeretin; 5-Desmethyltangeretin |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
|
| Chemical Family： |
Flavonoids |
| Canonical SMILES： |
COC1C=CC(=CC=1)C1=CC(=O)C2C(O)=C(OC)C(OC)=C(OC)C=2O1 |
| Botanical Source： |
the peel of Citrus sinensis (orange) and Citrus jambhiri. Also from Gardenia lucida, Brickellia spp. and Mentha spp. |
Previous: Desacetylcinobufagin
Next: Liquidambaric lactone
