Product Detail
Product Tags
| |
|
| Product name： |
Formononetin |
| Synonym： |
Formoononetin; Biochanin B; Neochanin; Pratol |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Off-white powder |
| Chemical Family： |
Flavonoids |
| Canonical SMILES： |
COC1=CC=C(C=C1)C1=COC2C=C(O)C=CC=2C1=O |
| Botanical Source： |
red and subterranean clovers (Trifolium pratense and Trifolium subterraneum) and of chick peas (Cicer arietinum). the heartwood of Pterocarpus indicus. Found also in Baptisia australis and other plants. Widely distributed in the L |
Previous: Trillin
Next: Demethoxycurcumin
