Product Detail
Product Tags
| |
|
| Product name： |
Eriodictyol |
| Synonym： |
|
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Off-white powder |
| Chemical Family： |
Flavonoids |
| Canonical SMILES： |
C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)O |
| Botanical Source： |
Widespread flavanone of the Compositae, also found in many dicot families (Rutaceae, Guttiferae, Labiatae, Rhamnaceae, Papaveraceae, Verbenaceae, Rubiaceae, Hydrangeaceae, Myoporaceae, Capparaceae, Ericaceae, Euphorbiaceae, Rosaceae, Hydrophyllaceae, Leg |
Previous: parthenolide
Next: 3-Isomangostin
