Product Detail
Product Tags
| |
|
| Product name： |
Ergosterol |
| Synonym： |
Ergosterin; Provitamin D2; Ertron |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Steroids |
| Canonical SMILES： |
CC(C)[C@@H](C)/C=C/[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| Botanical Source： |
yeast and fungi. The main fungal steroid. Also found in small amts. in higher plant prods., e.g. palm oil. Found in marine fungi and the green alga Bryopsis pennata |
Previous: Cyanidin-3-glucoside chloride
Next: Hecogenin
