Product Detail
Product Tags
| |
|
| Product name： |
Dulcitol |
| Synonym： |
galacto-Hexitol; Dulcose; Dulcite; Melampyrin; Euonymit; Melampyrum |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
|
| Chemical Family： |
|
| Canonical SMILES： |
O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H](O)CO |
| Botanical Source： |
Occurs in various mannas such as Melampyrum nemorosum, Gymnosporia diflexa and Maytenus ebenifolia. Also present in Evonymus atropurpureus, in seaweeds and in the pentose fermenting yeast Torula utilis |
Previous: Asarone
Next: Roburic Acid
