Product Detail
Product Tags
| |
|
| Product name： |
Dihydromyricetin |
| Synonym： |
|
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Flavonoids |
| Canonical SMILES： |
C1=C(C=C(C(=C1O)O)O)C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O |
| Botanical Source： |
Soymida febrifuga, Rhododendron spp., flowers of Eugenia jambolana (jambolan), Leptarrhena pyrofolia, Mahonia siamensis, Rhamnus pallasii, Cedrus deodara, Heuchera villosa, Adenanthera, Ampelopsis, Cercidiphyllum and Pinus spp. and others |
Previous: Trillin
Next: Demethoxycurcumin
