| Product name： | Deacetylasperulosidic acid |
| Synonym： | |
| Purity： | 98% + by HPLC |
| Appearance： | White powder |
| Chemical Family： | Iridoids |
| Canonical SMILES： | C1=C(C2C(C1O)C(=COC2OC3C(C(C(C(O3)CO)O)O)O)C(=O)O)CO |
| Botanical Source： | Rubia peregrina and Rubia tinctorum |
| Product name： | Deacetylasperulosidic acid |
| Synonym： | |
| Purity： | 98% + by HPLC |
| Appearance： | White powder |
| Chemical Family： | Iridoids |
| Canonical SMILES： | C1=C(C2C(C1O)C(=COC2OC3C(C(C(C(O3)CO)O)O)O)C(=O)O)CO |
| Botanical Source： | Rubia peregrina and Rubia tinctorum |
