Product Detail
Product Tags
| |
|
| Product name： |
Daidzein |
| Synonym： |
4′,7-Dihydroxyisoflavone ; Dimethylbiochanin B; Daizeol; K 251-6; Daidzeol; Tatoin; Isoaurostatin |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Isoflavones |
| Canonical SMILES： |
C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O)O |
| Botanical Source： |
Widespread isoflavone in the Leguminosae (Papilionoideae) e.g. in Chamaecytisus spp., Cytisus spp., Phaseolus spp. Also from Streptomyces xanthophaeus and Streptoverticillium album |
Previous: Astragaloside IV
Next: Alkannin
