Product Detail
Product Tags
| |
|
| Product name： |
Cyclosporin A |
| Synonym： |
Ciclosporin; Ramihyphin A; Sandimmun; Sandimmune |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Antibiotics |
| Canonical SMILES： |
CCC1C(=O)N(CC(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1)C(C(C)CC=CC)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C |
| Botanical Source： |
Metab. of Trichoderma inflatum NRRL 8044 (previously Trichoderma polysporum). Also Fusarium solani and Tolypocladium sinense |
Previous: Bellidifolin
Next: Erigeroside
