Product Detail
Product Tags
| |
|
| Product name： |
Corilagin |
| Synonym： |
|
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
white needle crystal |
| Chemical Family： |
Phenols |
| Canonical SMILES： |
OC1=CC(=CC(O)=C1O)C(=O)O[C@@H]1O[C@@H]2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(C=C(O)C(O)=C3O)C(=O)O[C@@H]([C@@H]2O)[C@H]1O |
| Botanical Source： |
leaves of Rhus spp., Eucalyptus spp., Acalypha sp., Anogeissus latifolia, Caesalpinia coriaria, Terminalia chebula, Schinopsis spp., Geranium sibiricum, Terminalia citriana, Chamaesyce hyssopifolia and other plants; also from Euphoria longana |
Previous: Lappaconitine hydrobromide
Next: Butyl 4-Hydroxybenzoate
