Product Detail
Product Tags
| |
|
| Product name： |
Chelidonine |
| Synonym： |
Stylophorine |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
white powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
CN1CC2C3OCOC=3C=CC=2[C@@H]2[C@H](O)CC3C=C4OCOC4=CC=3[C@H]12 |
| Botanical Source： |
Alkaloid from Root of Chelidonium majus and Stylophorum diphyllum, and the aerial parts of Glaucium fimbrilligerum. Chelidonine (with no stereochemical designation) has also been Symphoricarpos albus, Dicranostigma franchetianum, Dicentra |
Previous: Quercetin 3-O-β-D-glucose-7-O-β-D-gentiobioside
Next: Macranthoidin A
