Product Detail
Product Tags
| |
|
| Product name： |
Beta-Ecdysterone |
| Synonym： |
Ecdysterone; crustecdysone |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Steroids |
| Canonical SMILES： |
CC12CCC3C(=CC(=O)C4C3(CC(C(C4)O)O)C)C1(CCC2C(C)(C(CCC(C)(C)O)O)O)O |
| Botanical Source： |
the marine crayfish Jasus lalandei in low yield (2 mg/ton), saturniid oak-silk moth pupae, the silkworm, the wood of Podocarpus elatus and in Polypodium vulgare and many other plants |
Previous: parthenolide
Next: 3-Isomangostin
