Product Detail
Product Tags
| |
|
| Product name： |
Beta-Carotene |
| Synonym： |
Betacarotene, Carotaben; Phenoro; Solatene; β,β-Carotene; Provatene |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
|
| Chemical Family： |
|
| Canonical SMILES： |
CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CCCC2(C)C)C)C)C |
| Botanical Source： |
Widespread in plant and animal kingdoms. In plants it is almost always associated with chlorophyll. Occurs in marine organisms, e.g. sponges, esp. of the Poecilosclerida and Axinellida. |
Previous: Rhodojaponin-II
Next: 3,3′,4′-O-trimethylella-gic acid
