Product Detail
Product Tags
| |
|
| Product name： |
Berberrubine |
| Synonym： |
Chileninone |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Red needle crystal |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)O.[Cl-] |
| Botanical Source： |
Alkaloid from the twigs of Berberis actinacantha and from the stems of Berberis darwinii and Berberis valdiviana. Also from Berberis vulgaris, Thalictrum polygamum and Fibraurea chloroleuca (Berberidaceae, Ranunculaceae, Menispermaceae) |
Previous: Quercetin 3-O-β-D-glucose-7-O-β-D-gentiobioside
Next: Macranthoidin A
