Product Detail
Product Tags
| |
|
| Product name： |
Benzoylhypaconine |
| Synonym： |
Deacetylhypaconitine |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
CN1CC2(CCC(C34C2C(C(C31)C5(C6C4CC(C6OC(=O)C7=CC=CC=C7)(C(C5O)OC)O)O)OC)OC)COC |
| Botanical Source： |
Root of Aconitum carmichaeli (Ranunculaceae). Also the processed aconite “Kako-bushi-matsu’, produced by autoclaving the crude drug (‘bushi”) obt. from Root of some Aconitum spp. |
Previous: Cyanidin-3-glucoside chloride
Next: Hecogenin
