Product Detail
Product Tags
| |
|
| Product name： |
Aristolochic Acid B |
| Synonym： |
Aristolochic Acid II |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
|
| Chemical Family： |
Phenanthrenes |
| Canonical SMILES： |
[O-][N+](=O)C1=CC2C=CC=CC=2C2C3OCOC=3C=C(C(O)=O)C1=2 |
| Botanical Source： |
Alkaloid from Aristolochia argentina, Aristolochia clematitis, Aristolochia esperanzae, Aristolochia longa, Aristolochia manshuriensis, Aristolochia rotunda, Aristolochia pallida, Aristolochia sipho (Aristolochia durior) and from the Chinese drugs Ching- |
Previous: Isovitexin
Next: Camphor
