Product Detail
Product Tags
|
|
| Product name： |
Aristolochic acid A |
| Synonym： |
Aristolochic acid; Isoaristolochic acid; Aristolochin; Aristinic acid; Aristolochia yellow; Descresept; Tardolyt |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
|
| Chemical Family： |
Phenanthrenes |
| Canonical SMILES： |
COC1=CC=CC2=C3C(C(=CC4OCOC=43)C(O)=O)=C(C=C21)[N+]([O-])=O |
| Botanical Source： |
Alkaloid from a wide range of Aristolochia spp. Also found in the Chinese drug Fang-chi, Asarum canadense var. reflexum, Bragantia wallichii (preferred genus name Thottea), and in the butterflies Pachlioptera aristolochiae and Battus archidamas |
Previous: Isovitexin
Next: Camphor
