Product Detail
Product Tags
| |
|
| Product name： |
Arctiin |
| Synonym： |
|
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Off-white powder |
| Chemical Family： |
Lignans |
| Canonical SMILES： |
COC1=CC=C(C[C@H]2COC(=O)[C@@H]2CC2C=C(OC)C(=CC=2)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C=C1OC |
| Botanical Source： |
the seeds of Arctium lappa, stems of Trachelospermum asiaticum and from Forsythia intermedia, Centaurea spaerocephala and Centaurea imperialis. Widespread in the Compositae |
Previous: Talatisamine
Next: Curdione
