Product Detail
Product Tags
| |
|
| Product name： |
Apiin |
| Synonym： |
|
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Light yellow powder |
| Chemical Family： |
Flavonoids |
| Canonical SMILES： |
OC1=CC(=CC2OC(=CC(=O)C1=2)C1C=CC(O)=CC=1)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1OC[C@](O)(CO)[C@@H]1O |
| Botanical Source： |
parsley (Petroselinum crispum) and other Umbelliferae and of the flowers of Anthemis nobilis and from Limonium axillare and other plants. First isol. in 1843 |
Previous: Icariside I
Next: 3,5,6,7,8,3′,4′-Heptamethoxyflavone
