| Product name： | Apigenin |
| Synonym： | 4′,5,7-Trihydroxyflavone; Apigenol; Pelargidenone; Versulin |
| Purity： | 98% + by HPLC |
| Appearance： | Yellow powder |
| Chemical Family： | Flavonoids |
| Canonical SMILES： | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |
| Botanical Source： | Found free or as glycosides in the stems, roots, leaves, seeds or fruit of a very wide range of plant spp. Found also in some fossil leaf tissues |
